C12H14N2O3S — CID 65312807
2-(cyanomethylsulfanyl)-N-(1,3-dihydroxypropan-2-yl)benzamide (PubChem CID 65312807) has the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. Its IUPAC name is 2-(cyanomethylsulfanyl)-N-(1,3-dihydroxypropan-2-yl)benzamide.
| Compound Name | 2-(cyanomethylsulfanyl)-N-(1,3-dihydroxypropan-2-yl)benzamide |
|---|---|
| PubChem CID | 65312807 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 2-(cyanomethylsulfanyl)-N-(1,3-dihydroxypropan-2-yl)benzamide |
| SMILES | N#CCSc1ccccc1C(=O)NC(CO)CO |
| InChI | InChI=1S/C12H14N2O3S/c13-5-6-18-11-4-2-1-3-10(11)12(17)14-9(7-15)8-16/h1-4,9,15-16H,6-8H2,(H,14,17) |
| InChIKey | QIYMAWKAAPEWQZ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |