C13H14N2O4S — CID 81076404
2-[[2-(cyanomethylsulfanyl)benzoyl]amino]-3-methoxypropanoic acid (PubChem CID 81076404) has the molecular formula C13H14N2O4S and a molecular weight of 294.33 g/mol. Its IUPAC name is 2-[[2-(cyanomethylsulfanyl)benzoyl]amino]-3-methoxypropanoic acid.
| Compound Name | 2-[[2-(cyanomethylsulfanyl)benzoyl]amino]-3-methoxypropanoic acid |
|---|---|
| PubChem CID | 81076404 |
| Molecular Formula | C13H14N2O4S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 2-[[2-(cyanomethylsulfanyl)benzoyl]amino]-3-methoxypropanoic acid |
| SMILES | COCC(NC(=O)c1ccccc1SCC#N)C(=O)O |
| InChI | InChI=1S/C13H14N2O4S/c1-19-8-10(13(17)18)15-12(16)9-4-2-3-5-11(9)20-7-6-14/h2-5,10H,7-8H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | ROOJRXNJTZANIJ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |