About N-[(2,5-dimethylphenyl)methyl]-N-methylpropan-2-amine
N-[(2,5-dimethylphenyl)methyl]-N-methylpropan-2-amine (PubChem CID 117043979) has the molecular formula C13H21N
and a molecular weight of 191.32 g/mol. Its IUPAC name is N-[(2,5-dimethylphenyl)methyl]-N-methylpropan-2-amine.
Analyze N-[(2,5-dimethylphenyl)methyl]-N-methylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2,5-dimethylphenyl)methyl]-N-methylpropan-2-amine?
The IUPAC name of N-[(2,5-dimethylphenyl)methyl]-N-methylpropan-2-amine (CID 117043979) is N-[(2,5-dimethylphenyl)methyl]-N-methylpropan-2-amine.
What is the SMILES notation for N-[(2,5-dimethylphenyl)methyl]-N-methylpropan-2-amine?
The canonical SMILES for N-[(2,5-dimethylphenyl)methyl]-N-methylpropan-2-amine is Cc1ccc(C)c(CN(C)C(C)C)c1.
What is the InChIKey of N-[(2,5-dimethylphenyl)methyl]-N-methylpropan-2-amine?
The InChIKey is KIKQRZXKZBTTSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N/c1-10(2)14(5)9-13-8-11(3)6-7-12(13)4/h6-8,10H,9H2,1-5H3.
What are the key properties of N-[(2,5-dimethylphenyl)methyl]-N-methylpropan-2-amine?
N-[(2,5-dimethylphenyl)methyl]-N-methylpropan-2-amine has a molecular weight of 191.32 g/mol, XLogP of 3.14, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2,5-dimethylphenyl)methyl]-N-methylpropan-2-amine is sourced from PubChem (CID 117043979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).