C11H12Cl2 — CID 24722016
1,2-dichloro-4-(3-methylbut-3-enyl)benzene (PubChem CID 24722016) has the molecular formula C11H12Cl2 and a molecular weight of 215.12 g/mol. Its IUPAC name is 1,2-dichloro-4-(3-methylbut-3-enyl)benzene.
| Compound Name | 1,2-dichloro-4-(3-methylbut-3-enyl)benzene |
|---|---|
| PubChem CID | 24722016 |
| Molecular Formula | C11H12Cl2 |
| Molecular Weight | 215.12 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | 1,2-dichloro-4-(3-methylbut-3-enyl)benzene |
| SMILES | C=C(C)CCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H12Cl2/c1-8(2)3-4-9-5-6-10(12)11(13)7-9/h5-7H,1,3-4H2,2H3 |
| InChIKey | NVEOKVBXFPRDLZ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.12 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|