C18H38O6S — CID 172628738
1,1,1-triethoxy-3-(3,3,3-triethoxypropylsulfanyl)propane (PubChem CID 172628738) has the molecular formula C18H38O6S and a molecular weight of 382.56 g/mol. Its IUPAC name is 1,1,1-triethoxy-3-(3,3,3-triethoxypropylsulfanyl)propane.
| Compound Name | 1,1,1-triethoxy-3-(3,3,3-triethoxypropylsulfanyl)propane |
|---|---|
| PubChem CID | 172628738 |
| Molecular Formula | C18H38O6S |
| Molecular Weight | 382.56 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | 1,1,1-triethoxy-3-(3,3,3-triethoxypropylsulfanyl)propane |
| SMILES | CCOC(CCSCCC(OCC)(OCC)OCC)(OCC)OCC |
| InChI | InChI=1S/C18H38O6S/c1-7-19-17(20-8-2,21-9-3)13-15-25-16-14-18(22-10-4,23-11-5)24-12-6/h7-16H2,1-6H3 |
| InChIKey | NEZVKKGXWDZYRP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.56 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|