C17H35NO7Si — CID 175533703
4-(oxiran-2-ylmethoxy)-3-(oxiran-2-ylmethoxymethyl)-3-triethoxysilylbutan-1-amine (PubChem CID 175533703) has the molecular formula C17H35NO7Si and a molecular weight of 393.55 g/mol. Its IUPAC name is 4-(oxiran-2-ylmethoxy)-3-(oxiran-2-ylmethoxymethyl)-3-triethoxysilylbutan-1-amine.
| Compound Name | 4-(oxiran-2-ylmethoxy)-3-(oxiran-2-ylmethoxymethyl)-3-triethoxysilylbutan-1-amine |
|---|---|
| PubChem CID | 175533703 |
| Molecular Formula | C17H35NO7Si |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | 4-(oxiran-2-ylmethoxy)-3-(oxiran-2-ylmethoxymethyl)-3-triethoxysilylbutan-1-amine |
| SMILES | CCO[Si](OCC)(OCC)C(CCN)(COCC1CO1)COCC1CO1 |
| InChI | InChI=1S/C17H35NO7Si/c1-4-23-26(24-5-2,25-6-3)17(7-8-18,13-19-9-15-11-21-15)14-20-10-16-12-22-16/h15-16H,4-14,18H2,1-3H3 |
| InChIKey | AEYOQZXAWABUHQ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 97.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|