About oxiran-2-ylmethyl 2-[3,5,7-tris[2-(oxiran-2-ylmethoxy)-2-oxoethyl]-1-adamantyl]acetate
oxiran-2-ylmethyl 2-[3,5,7-tris[2-(oxiran-2-ylmethoxy)-2-oxoethyl]-1-adamantyl]acetate (PubChem CID 87387868) has the molecular formula C30H40O12
and a molecular weight of 592.64 g/mol. Its IUPAC name is oxiran-2-ylmethyl 2-[3,5,7-tris[2-(oxiran-2-ylmethoxy)-2-oxoethyl]-1-adamantyl]acetate.
Molecular Properties
| Compound Name | oxiran-2-ylmethyl 2-[3,5,7-tris[2-(oxiran-2-ylmethoxy)-2-oxoethyl]-1-adamantyl]acetate |
| PubChem CID | 87387868 |
| Molecular Formula | C30H40O12 |
| Molecular Weight | 592.64 g/mol |
| Exact Mass | 592.25 |
| IUPAC Name | oxiran-2-ylmethyl 2-[3,5,7-tris[2-(oxiran-2-ylmethoxy)-2-oxoethyl]-1-adamantyl]acetate |
| SMILES | O=C(CC12CC3(CC(=O)OCC4CO4)CC(CC(=O)OCC4CO4)(C1)CC(CC(=O)OCC1CO1)(C2)C3)OCC1CO1 |
| InChI | InChI=1S/C30H40O12/c31-23(39-9-19-5-35-19)1-27-13-28(2-24(32)40-10-20-6-36-20)16-29(14-27,3-25(33)41-11-21-7-37-21)18-30(15-27,17-28)4-26(34)42-12-22-8-38-22/h19-22H,1-18H2 |
| InChIKey | XUBQGQHQEBJRHS-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 155.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 592.64 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze oxiran-2-ylmethyl 2-[3,5,7-tris[2-(oxiran-2-ylmethoxy)-2-oxoethyl]-1-adamantyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxiran-2-ylmethyl 2-[3,5,7-tris[2-(oxiran-2-ylmethoxy)-2-oxoethyl]-1-adamantyl]acetate?
The IUPAC name of oxiran-2-ylmethyl 2-[3,5,7-tris[2-(oxiran-2-ylmethoxy)-2-oxoethyl]-1-adamantyl]acetate (CID 87387868) is oxiran-2-ylmethyl 2-[3,5,7-tris[2-(oxiran-2-ylmethoxy)-2-oxoethyl]-1-adamantyl]acetate.
What is the SMILES notation for oxiran-2-ylmethyl 2-[3,5,7-tris[2-(oxiran-2-ylmethoxy)-2-oxoethyl]-1-adamantyl]acetate?
The canonical SMILES for oxiran-2-ylmethyl 2-[3,5,7-tris[2-(oxiran-2-ylmethoxy)-2-oxoethyl]-1-adamantyl]acetate is O=C(CC12CC3(CC(=O)OCC4CO4)CC(CC(=O)OCC4CO4)(C1)CC(CC(=O)OCC1CO1)(C2)C3)OCC1CO1.
What is the InChIKey of oxiran-2-ylmethyl 2-[3,5,7-tris[2-(oxiran-2-ylmethoxy)-2-oxoethyl]-1-adamantyl]acetate?
The InChIKey is XUBQGQHQEBJRHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H40O12/c31-23(39-9-19-5-35-19)1-27-13-28(2-24(32)40-10-20-6-36-20)16-29(14-27,3-25(33)41-11-21-7-37-21)18-30(15-27,17-28)4-26(34)42-12-22-8-38-22/h19-22H,1-18H2.
What are the key properties of oxiran-2-ylmethyl 2-[3,5,7-tris[2-(oxiran-2-ylmethoxy)-2-oxoethyl]-1-adamantyl]acetate?
oxiran-2-ylmethyl 2-[3,5,7-tris[2-(oxiran-2-ylmethoxy)-2-oxoethyl]-1-adamantyl]acetate has a molecular weight of 592.64 g/mol, XLogP of 1.64, 16 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for oxiran-2-ylmethyl 2-[3,5,7-tris[2-(oxiran-2-ylmethoxy)-2-oxoethyl]-1-adamantyl]acetate is sourced from PubChem (CID 87387868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).