C19H32O4 — CID 159024762
[5-(2-hydroxyethoxy)-2-methyl-2-adamantyl] 2,2-dimethylbutanoate (PubChem CID 159024762) has the molecular formula C19H32O4 and a molecular weight of 324.46 g/mol. Its IUPAC name is [5-(2-hydroxyethoxy)-2-methyl-2-adamantyl] 2,2-dimethylbutanoate.
| Compound Name | [5-(2-hydroxyethoxy)-2-methyl-2-adamantyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 159024762 |
| Molecular Formula | C19H32O4 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | [5-(2-hydroxyethoxy)-2-methyl-2-adamantyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1(C)C2CC3CC1CC(OCCO)(C3)C2 |
| InChI | InChI=1S/C19H32O4/c1-5-17(2,3)16(21)23-18(4)14-8-13-9-15(18)12-19(10-13,11-14)22-7-6-20/h13-15,20H,5-12H2,1-4H3 |
| InChIKey | QKZHKHZOFHZMCO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |