C21H36O2 — CID 58927090
2-(1-adamantyl)hexan-2-yl 2-methylbutanoate (PubChem CID 58927090) has the molecular formula C21H36O2 and a molecular weight of 320.52 g/mol. Its IUPAC name is 2-(1-adamantyl)hexan-2-yl 2-methylbutanoate.
| Compound Name | 2-(1-adamantyl)hexan-2-yl 2-methylbutanoate |
|---|---|
| PubChem CID | 58927090 |
| Molecular Formula | C21H36O2 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.27 |
| IUPAC Name | 2-(1-adamantyl)hexan-2-yl 2-methylbutanoate |
| SMILES | CCCCC(C)(OC(=O)C(C)CC)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H36O2/c1-5-7-8-20(4,23-19(22)15(3)6-2)21-12-16-9-17(13-21)11-18(10-16)14-21/h15-18H,5-14H2,1-4H3 |
| InChIKey | MRRXTNIKVAUNKS-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |