C18H32O3 — CID 91040572
2-adamantyloxymethyl 2-methylbutanoate;ethane (PubChem CID 91040572) has the molecular formula C18H32O3 and a molecular weight of 296.45 g/mol. Its IUPAC name is 2-adamantyloxymethyl 2-methylbutanoate;ethane.
| Compound Name | 2-adamantyloxymethyl 2-methylbutanoate;ethane |
|---|---|
| PubChem CID | 91040572 |
| Molecular Formula | C18H32O3 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.24 |
| IUPAC Name | 2-adamantyloxymethyl 2-methylbutanoate;ethane |
| SMILES | CC.CCC(C)C(=O)OCOC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C16H26O3.C2H6/c1-3-10(2)16(17)19-9-18-15-13-5-11-4-12(7-13)8-14(15)6-11;1-2/h10-15H,3-9H2,1-2H3;1-2H3 |
| InChIKey | XQIARLVKHBEUKH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|