About 2-tricyclo[7.7.5.32,8]tetracosanyl N-[2-(dimethylamino)ethyl]carbamate
2-tricyclo[7.7.5.32,8]tetracosanyl N-[2-(dimethylamino)ethyl]carbamate (PubChem CID 139468482) has the molecular formula C29H54N2O2
and a molecular weight of 462.76 g/mol. Its IUPAC name is 2-tricyclo[7.7.5.32,8]tetracosanyl N-[2-(dimethylamino)ethyl]carbamate.
Molecular Properties
| Compound Name | 2-tricyclo[7.7.5.32,8]tetracosanyl N-[2-(dimethylamino)ethyl]carbamate |
| PubChem CID | 139468482 |
| Molecular Formula | C29H54N2O2 |
| Molecular Weight | 462.76 g/mol |
| Exact Mass | 462.42 |
| IUPAC Name | 2-tricyclo[7.7.5.32,8]tetracosanyl N-[2-(dimethylamino)ethyl]carbamate |
| SMILES | CN(C)CCNC(=O)OC12CCCCCC(CCC1)C1CCCCCCCC2CCCCC1 |
| InChI | InChI=1S/C29H54N2O2/c1-31(2)24-23-30-28(32)33-29-21-13-7-10-17-26(18-14-22-29)25-15-8-4-3-5-11-19-27(29)20-12-6-9-16-25/h25-27H,3-24H2,1-2H3,(H,30,32) |
| InChIKey | XEJQKSQTBJGHEJ-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 462.76 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-tricyclo[7.7.5.32,8]tetracosanyl N-[2-(dimethylamino)ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tricyclo[7.7.5.32,8]tetracosanyl N-[2-(dimethylamino)ethyl]carbamate?
The IUPAC name of 2-tricyclo[7.7.5.32,8]tetracosanyl N-[2-(dimethylamino)ethyl]carbamate (CID 139468482) is 2-tricyclo[7.7.5.32,8]tetracosanyl N-[2-(dimethylamino)ethyl]carbamate.
What is the SMILES notation for 2-tricyclo[7.7.5.32,8]tetracosanyl N-[2-(dimethylamino)ethyl]carbamate?
The canonical SMILES for 2-tricyclo[7.7.5.32,8]tetracosanyl N-[2-(dimethylamino)ethyl]carbamate is CN(C)CCNC(=O)OC12CCCCCC(CCC1)C1CCCCCCCC2CCCCC1.
What is the InChIKey of 2-tricyclo[7.7.5.32,8]tetracosanyl N-[2-(dimethylamino)ethyl]carbamate?
The InChIKey is XEJQKSQTBJGHEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H54N2O2/c1-31(2)24-23-30-28(32)33-29-21-13-7-10-17-26(18-14-22-29)25-15-8-4-3-5-11-19-27(29)20-12-6-9-16-25/h25-27H,3-24H2,1-2H3,(H,30,32).
What are the key properties of 2-tricyclo[7.7.5.32,8]tetracosanyl N-[2-(dimethylamino)ethyl]carbamate?
2-tricyclo[7.7.5.32,8]tetracosanyl N-[2-(dimethylamino)ethyl]carbamate has a molecular weight of 462.76 g/mol, XLogP of 7.70, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tricyclo[7.7.5.32,8]tetracosanyl N-[2-(dimethylamino)ethyl]carbamate is sourced from PubChem (CID 139468482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).