C21H36O4 — CID 172565484
(E)-4-[2-methyl-1-[4-(2-methylbutan-2-yl)cyclohexyl]pentan-2-yl]oxy-4-oxobut-2-enoic acid (PubChem CID 172565484) has the molecular formula C21H36O4 and a molecular weight of 352.52 g/mol. Its IUPAC name is (E)-4-[2-methyl-1-[4-(2-methylbutan-2-yl)cyclohexyl]pentan-2-yl]oxy-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[2-methyl-1-[4-(2-methylbutan-2-yl)cyclohexyl]pentan-2-yl]oxy-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 172565484 |
| Molecular Formula | C21H36O4 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.26 |
| IUPAC Name | (E)-4-[2-methyl-1-[4-(2-methylbutan-2-yl)cyclohexyl]pentan-2-yl]oxy-4-oxobut-2-enoic acid |
| SMILES | CCCC(C)(CC1CCC(C(C)(C)CC)CC1)OC(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C21H36O4/c1-6-14-21(5,25-19(24)13-12-18(22)23)15-16-8-10-17(11-9-16)20(3,4)7-2/h12-13,16-17H,6-11,14-15H2,1-5H3,(H,22,23)/b13-12+ |
| InChIKey | AOXFYOVRSPCAJI-OUKQBFOZSA-N |
| XLogP | 5.36 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|