C22H29N3O2 — CID 142067129
4-phenylbutyl 1-(N-aminoanilino)piperidine-2-carboxylate (PubChem CID 142067129) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is 4-phenylbutyl 1-(N-aminoanilino)piperidine-2-carboxylate.
| Compound Name | 4-phenylbutyl 1-(N-aminoanilino)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 142067129 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | 4-phenylbutyl 1-(N-aminoanilino)piperidine-2-carboxylate |
| SMILES | NN(c1ccccc1)N1CCCCC1C(=O)OCCCCc1ccccc1 |
| InChI | InChI=1S/C22H29N3O2/c23-25(20-14-5-2-6-15-20)24-17-9-7-16-21(24)22(26)27-18-10-8-13-19-11-3-1-4-12-19/h1-6,11-12,14-15,21H,7-10,13,16-18,23H2 |
| InChIKey | NMJFHMFYLKWHSY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|