C26H35N3O5S — CID 18613547
4-phenylbutyl 1-[(4-morpholin-4-ylphenyl)sulfamoyl]piperidine-2-carboxylate (PubChem CID 18613547) has the molecular formula C26H35N3O5S and a molecular weight of 501.65 g/mol. Its IUPAC name is 4-phenylbutyl 1-[(4-morpholin-4-ylphenyl)sulfamoyl]piperidine-2-carboxylate.
| Compound Name | 4-phenylbutyl 1-[(4-morpholin-4-ylphenyl)sulfamoyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 18613547 |
| Molecular Formula | C26H35N3O5S |
| Molecular Weight | 501.65 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | 4-phenylbutyl 1-[(4-morpholin-4-ylphenyl)sulfamoyl]piperidine-2-carboxylate |
| SMILES | O=C(OCCCCc1ccccc1)C1CCCCN1S(=O)(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C26H35N3O5S/c30-26(34-19-7-5-10-22-8-2-1-3-9-22)25-11-4-6-16-29(25)35(31,32)27-23-12-14-24(15-13-23)28-17-20-33-21-18-28/h1-3,8-9,12-15,25,27H,4-7,10-11,16-21H2 |
| InChIKey | YCLCBFNUWPBSKN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.65 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|