C23H30N4O3 — CID 59893765
benzyl (2S)-1-[[(6-morpholin-4-yl-3-pyridinyl)amino]methyl]piperidine-2-carboxylate (PubChem CID 59893765) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is benzyl (2S)-1-[[(6-morpholin-4-yl-3-pyridinyl)amino]methyl]piperidine-2-carboxylate.
| Compound Name | benzyl (2S)-1-[[(6-morpholin-4-yl-3-pyridinyl)amino]methyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 59893765 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | benzyl (2S)-1-[[(6-morpholin-4-yl-3-pyridinyl)amino]methyl]piperidine-2-carboxylate |
| SMILES | O=C(OCc1ccccc1)[C@@H]1CCCCN1CNc1ccc(N2CCOCC2)nc1 |
| InChI | InChI=1S/C23H30N4O3/c28-23(30-17-19-6-2-1-3-7-19)21-8-4-5-11-27(21)18-25-20-9-10-22(24-16-20)26-12-14-29-15-13-26/h1-3,6-7,9-10,16,21,25H,4-5,8,11-15,17-18H2/t21-/m0/s1 |
| InChIKey | WCFHGNJRROZFDQ-NRFANRHFSA-N |
| XLogP | 2.89 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |