C37H45NO8 — CID 67846651
[4-[(E)-1-[4-[2-acetyloxy-3-(propylamino)propoxy]phenyl]-2-(1,3-benzodioxol-5-yl)but-1-enyl]phenoxy]methyl 2,2-dimethylpropanoate (PubChem CID 67846651) has the molecular formula C37H45NO8 and a molecular weight of 631.77 g/mol. Its IUPAC name is [4-[(E)-1-[4-[2-acetyloxy-3-(propylamino)propoxy]phenyl]-2-(1,3-benzodioxol-5-yl)but-1-enyl]phenoxy]methyl 2,2-dimethylpropanoate.
| Compound Name | [4-[(E)-1-[4-[2-acetyloxy-3-(propylamino)propoxy]phenyl]-2-(1,3-benzodioxol-5-yl)but-1-enyl]phenoxy]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 67846651 |
| Molecular Formula | C37H45NO8 |
| Molecular Weight | 631.77 g/mol |
| Exact Mass | 631.31 |
| IUPAC Name | [4-[(E)-1-[4-[2-acetyloxy-3-(propylamino)propoxy]phenyl]-2-(1,3-benzodioxol-5-yl)but-1-enyl]phenoxy]methyl 2,2-dimethylpropanoate |
| SMILES | CCCNCC(COc1ccc(/C(=C(/CC)c2ccc3c(c2)OCO3)c2ccc(OCOC(=O)C(C)(C)C)cc2)cc1)OC(C)=O |
| InChI | InChI=1S/C37H45NO8/c1-7-19-38-21-31(46-25(3)39)22-41-29-14-9-26(10-15-29)35(32(8-2)28-13-18-33-34(20-28)44-24-43-33)27-11-16-30(17-12-27)42-23-45-36(40)37(4,5)6/h9-18,20,31,38H,7-8,19,21-24H2,1-6H3/b35-32+ |
| InChIKey | ZIAGPXULNTYRLR-LVYIWIAJSA-N |
| XLogP | 7.02 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.77 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|