C32H38NO6P — CID 67846625
[4-[2-(1,3-benzodioxol-5-yl)-1-[4-[2-(cyclohexylmethylamino)ethoxy]phenyl]but-1-enyl]phenyl] dihydrogen phosphite (PubChem CID 67846625) has the molecular formula C32H38NO6P and a molecular weight of 563.63 g/mol. Its IUPAC name is [4-[2-(1,3-benzodioxol-5-yl)-1-[4-[2-(cyclohexylmethylamino)ethoxy]phenyl]but-1-enyl]phenyl] dihydrogen phosphite.
| Compound Name | [4-[2-(1,3-benzodioxol-5-yl)-1-[4-[2-(cyclohexylmethylamino)ethoxy]phenyl]but-1-enyl]phenyl] dihydrogen phosphite |
|---|---|
| PubChem CID | 67846625 |
| Molecular Formula | C32H38NO6P |
| Molecular Weight | 563.63 g/mol |
| Exact Mass | 563.24 |
| IUPAC Name | [4-[2-(1,3-benzodioxol-5-yl)-1-[4-[2-(cyclohexylmethylamino)ethoxy]phenyl]but-1-enyl]phenyl] dihydrogen phosphite |
| SMILES | CCC(=C(c1ccc(OCCNCC2CCCCC2)cc1)c1ccc(OP(O)O)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C32H38NO6P/c1-2-29(26-12-17-30-31(20-26)38-22-37-30)32(25-10-15-28(16-11-25)39-40(34)35)24-8-13-27(14-9-24)36-19-18-33-21-23-6-4-3-5-7-23/h8-17,20,23,33-35H,2-7,18-19,21-22H2,1H3 |
| InChIKey | GGELCRFERDSWDO-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 89.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.63 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|