C30H33NO4 — CID 67846779
4-[2-(1,3-benzodioxol-5-yl)-2-cyclopropyl-1-[4-[2-(diethylamino)ethoxy]phenyl]ethenyl]phenol (PubChem CID 67846779) has the molecular formula C30H33NO4 and a molecular weight of 471.60 g/mol. Its IUPAC name is 4-[2-(1,3-benzodioxol-5-yl)-2-cyclopropyl-1-[4-[2-(diethylamino)ethoxy]phenyl]ethenyl]phenol.
| Compound Name | 4-[2-(1,3-benzodioxol-5-yl)-2-cyclopropyl-1-[4-[2-(diethylamino)ethoxy]phenyl]ethenyl]phenol |
|---|---|
| PubChem CID | 67846779 |
| Molecular Formula | C30H33NO4 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | 4-[2-(1,3-benzodioxol-5-yl)-2-cyclopropyl-1-[4-[2-(diethylamino)ethoxy]phenyl]ethenyl]phenol |
| SMILES | CCN(CC)CCOc1ccc(C(=C(c2ccc3c(c2)OCO3)C2CC2)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C30H33NO4/c1-3-31(4-2)17-18-33-26-14-9-23(10-15-26)29(22-7-12-25(32)13-8-22)30(21-5-6-21)24-11-16-27-28(19-24)35-20-34-27/h7-16,19,21,32H,3-6,17-18,20H2,1-2H3 |
| InChIKey | YWKGGNIZPPKKGZ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|