C30H33NO5 — CID 67846983
4-[2-(1,3-benzodioxol-5-yl)-2-cyclopropyl-1-[4-[2-hydroxy-3-(methylamino)pentoxy]phenyl]ethenyl]phenol (PubChem CID 67846983) has the molecular formula C30H33NO5 and a molecular weight of 487.60 g/mol. Its IUPAC name is 4-[2-(1,3-benzodioxol-5-yl)-2-cyclopropyl-1-[4-[2-hydroxy-3-(methylamino)pentoxy]phenyl]ethenyl]phenol.
| Compound Name | 4-[2-(1,3-benzodioxol-5-yl)-2-cyclopropyl-1-[4-[2-hydroxy-3-(methylamino)pentoxy]phenyl]ethenyl]phenol |
|---|---|
| PubChem CID | 67846983 |
| Molecular Formula | C30H33NO5 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | 4-[2-(1,3-benzodioxol-5-yl)-2-cyclopropyl-1-[4-[2-hydroxy-3-(methylamino)pentoxy]phenyl]ethenyl]phenol |
| SMILES | CCC(NC)C(O)COc1ccc(C(=C(c2ccc3c(c2)OCO3)C2CC2)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C30H33NO5/c1-3-25(31-2)26(33)17-34-24-13-8-21(9-14-24)29(20-6-11-23(32)12-7-20)30(19-4-5-19)22-10-15-27-28(16-22)36-18-35-27/h6-16,19,25-26,31-33H,3-5,17-18H2,1-2H3 |
| InChIKey | XXEBLCRRSDZMPP-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 80.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|