C27H28N2O3 — CID 15123161
2-[4-[2-(diethylamino)ethoxy]phenyl]-3,3-bis(4-hydroxyphenyl)prop-2-enenitrile (PubChem CID 15123161) has the molecular formula C27H28N2O3 and a molecular weight of 428.53 g/mol. Its IUPAC name is 2-[4-[2-(diethylamino)ethoxy]phenyl]-3,3-bis(4-hydroxyphenyl)prop-2-enenitrile.
| Compound Name | 2-[4-[2-(diethylamino)ethoxy]phenyl]-3,3-bis(4-hydroxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 15123161 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 2-[4-[2-(diethylamino)ethoxy]phenyl]-3,3-bis(4-hydroxyphenyl)prop-2-enenitrile |
| SMILES | CCN(CC)CCOc1ccc(C(C#N)=C(c2ccc(O)cc2)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C27H28N2O3/c1-3-29(4-2)17-18-32-25-15-9-20(10-16-25)26(19-28)27(21-5-11-23(30)12-6-21)22-7-13-24(31)14-8-22/h5-16,30-31H,3-4,17-18H2,1-2H3 |
| InChIKey | MXQOGXRSTWQMEO-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|