C12H18N2O — CID 79226752
N'-(2,3-dihydro-1-benzofuran-3-ylmethyl)propane-1,3-diamine (PubChem CID 79226752) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is N'-(2,3-dihydro-1-benzofuran-3-ylmethyl)propane-1,3-diamine.
| Compound Name | N'-(2,3-dihydro-1-benzofuran-3-ylmethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 79226752 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | N'-(2,3-dihydro-1-benzofuran-3-ylmethyl)propane-1,3-diamine |
| SMILES | NCCCNCC1COc2ccccc21 |
| InChI | InChI=1S/C12H18N2O/c13-6-3-7-14-8-10-9-15-12-5-2-1-4-11(10)12/h1-2,4-5,10,14H,3,6-9,13H2 |
| InChIKey | PRXBRGGMIWGHOR-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|