C14H20BrNO — CID 107320375
5-bromo-N-(2,3-dihydro-1-benzofuran-3-ylmethyl)pentan-1-amine (PubChem CID 107320375) has the molecular formula C14H20BrNO and a molecular weight of 298.22 g/mol. Its IUPAC name is 5-bromo-N-(2,3-dihydro-1-benzofuran-3-ylmethyl)pentan-1-amine.
| Compound Name | 5-bromo-N-(2,3-dihydro-1-benzofuran-3-ylmethyl)pentan-1-amine |
|---|---|
| PubChem CID | 107320375 |
| Molecular Formula | C14H20BrNO |
| Molecular Weight | 298.22 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 5-bromo-N-(2,3-dihydro-1-benzofuran-3-ylmethyl)pentan-1-amine |
| SMILES | BrCCCCCNCC1COc2ccccc21 |
| InChI | InChI=1S/C14H20BrNO/c15-8-4-1-5-9-16-10-12-11-17-14-7-3-2-6-13(12)14/h2-3,6-7,12,16H,1,4-5,8-11H2 |
| InChIKey | QPEFRRCAFVEYIA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.22 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|