C29H27N3O3S — CID 26360594
2-(1-benzothiophen-2-ylmethyl)-4-[4-[(2-methoxyphenyl)methyl]piperazin-1-yl]isoindole-1,3-dione (PubChem CID 26360594) has the molecular formula C29H27N3O3S and a molecular weight of 497.62 g/mol. Its IUPAC name is 2-(1-benzothiophen-2-ylmethyl)-4-[4-[(2-methoxyphenyl)methyl]piperazin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-(1-benzothiophen-2-ylmethyl)-4-[4-[(2-methoxyphenyl)methyl]piperazin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 26360594 |
| Molecular Formula | C29H27N3O3S |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | 2-(1-benzothiophen-2-ylmethyl)-4-[4-[(2-methoxyphenyl)methyl]piperazin-1-yl]isoindole-1,3-dione |
| SMILES | COc1ccccc1CN1CCN(c2cccc3c2C(=O)N(Cc2cc4ccccc4s2)C3=O)CC1 |
| InChI | InChI=1S/C29H27N3O3S/c1-35-25-11-4-2-8-21(25)18-30-13-15-31(16-14-30)24-10-6-9-23-27(24)29(34)32(28(23)33)19-22-17-20-7-3-5-12-26(20)36-22/h2-12,17H,13-16,18-19H2,1H3 |
| InChIKey | YVVITUVUJFBTMI-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|