C28H31N3O4 — CID 30854081
4-[4-[(2-methoxynaphthalen-1-yl)methyl]piperazin-1-yl]-2-(3-methoxypropyl)isoindole-1,3-dione (PubChem CID 30854081) has the molecular formula C28H31N3O4 and a molecular weight of 473.57 g/mol. Its IUPAC name is 4-[4-[(2-methoxynaphthalen-1-yl)methyl]piperazin-1-yl]-2-(3-methoxypropyl)isoindole-1,3-dione.
| Compound Name | 4-[4-[(2-methoxynaphthalen-1-yl)methyl]piperazin-1-yl]-2-(3-methoxypropyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 30854081 |
| Molecular Formula | C28H31N3O4 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | 4-[4-[(2-methoxynaphthalen-1-yl)methyl]piperazin-1-yl]-2-(3-methoxypropyl)isoindole-1,3-dione |
| SMILES | COCCCN1C(=O)c2cccc(N3CCN(Cc4c(OC)ccc5ccccc45)CC3)c2C1=O |
| InChI | InChI=1S/C28H31N3O4/c1-34-18-6-13-31-27(32)22-9-5-10-24(26(22)28(31)33)30-16-14-29(15-17-30)19-23-21-8-4-3-7-20(21)11-12-25(23)35-2/h3-5,7-12H,6,13-19H2,1-2H3 |
| InChIKey | COELXHNIXJMHNM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|