C31H35N3O4 — CID 23627671
2-[(3,4-dimethoxyphenyl)methyl]-4-[4-(2-methyl-1-phenylpropyl)piperazin-1-yl]isoindole-1,3-dione (PubChem CID 23627671) has the molecular formula C31H35N3O4 and a molecular weight of 513.64 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methyl]-4-[4-(2-methyl-1-phenylpropyl)piperazin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methyl]-4-[4-(2-methyl-1-phenylpropyl)piperazin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 23627671 |
| Molecular Formula | C31H35N3O4 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.26 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methyl]-4-[4-(2-methyl-1-phenylpropyl)piperazin-1-yl]isoindole-1,3-dione |
| SMILES | COc1ccc(CN2C(=O)c3cccc(N4CCN(C(c5ccccc5)C(C)C)CC4)c3C2=O)cc1OC |
| InChI | InChI=1S/C31H35N3O4/c1-21(2)29(23-9-6-5-7-10-23)33-17-15-32(16-18-33)25-12-8-11-24-28(25)31(36)34(30(24)35)20-22-13-14-26(37-3)27(19-22)38-4/h5-14,19,21,29H,15-18,20H2,1-4H3 |
| InChIKey | RWZULKZFFFRPGS-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|