C29H30ClN3O4 — CID 23627431
4-chloro-2-[(3,4-dimethoxyphenyl)methyl]-7-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindole-1,3-dione (PubChem CID 23627431) has the molecular formula C29H30ClN3O4 and a molecular weight of 520.03 g/mol. Its IUPAC name is 4-chloro-2-[(3,4-dimethoxyphenyl)methyl]-7-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindole-1,3-dione.
| Compound Name | 4-chloro-2-[(3,4-dimethoxyphenyl)methyl]-7-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 23627431 |
| Molecular Formula | C29H30ClN3O4 |
| Molecular Weight | 520.03 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | 4-chloro-2-[(3,4-dimethoxyphenyl)methyl]-7-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindole-1,3-dione |
| SMILES | COc1ccc(CN2C(=O)c3c(Cl)ccc(N4CCN([C@H](C)c5ccccc5)CC4)c3C2=O)cc1OC |
| InChI | InChI=1S/C29H30ClN3O4/c1-19(21-7-5-4-6-8-21)31-13-15-32(16-14-31)23-11-10-22(30)26-27(23)29(35)33(28(26)34)18-20-9-12-24(36-2)25(17-20)37-3/h4-12,17,19H,13-16,18H2,1-3H3/t19-/m1/s1 |
| InChIKey | VJSUTJABKMCTGW-LJQANCHMSA-N |
| XLogP | 5.04 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.03 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|