C39H48N4O5 — CID 143506532
N-[(4R)-5-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]pentyl]cyclopentanecarboxamide (PubChem CID 143506532) has the molecular formula C39H48N4O5 and a molecular weight of 652.84 g/mol. Its IUPAC name is N-[(4R)-5-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]pentyl]cyclopentanecarboxamide.
| Compound Name | N-[(4R)-5-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]pentyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 143506532 |
| Molecular Formula | C39H48N4O5 |
| Molecular Weight | 652.84 g/mol |
| Exact Mass | 652.36 |
| IUPAC Name | N-[(4R)-5-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]pentyl]cyclopentanecarboxamide |
| SMILES | COc1ccc(C[C@@H](CCCNC(=O)C2CCCC2)N2C(=O)c3cccc(N4CCN([C@H](C)c5ccccc5)CC4)c3C2=O)cc1OC |
| InChI | InChI=1S/C39H48N4O5/c1-27(29-11-5-4-6-12-29)41-21-23-42(24-22-41)33-17-9-16-32-36(33)39(46)43(38(32)45)31(15-10-20-40-37(44)30-13-7-8-14-30)25-28-18-19-34(47-2)35(26-28)48-3/h4-6,9,11-12,16-19,26-27,30-31H,7-8,10,13-15,20-25H2,1-3H3,(H,40,44)/t27-,31-/m1/s1 |
| InChIKey | DMFOXBIZULVYNF-DLFZDVPBSA-N |
| XLogP | 5.88 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.84 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|