C24H25F2N3O3 — CID 42484794
4-[4-[(2,4-difluorophenyl)methyl]piperazin-1-yl]-2-[[(2R)-oxolan-2-yl]methyl]isoindole-1,3-dione (PubChem CID 42484794) has the molecular formula C24H25F2N3O3 and a molecular weight of 441.48 g/mol. Its IUPAC name is 4-[4-[(2,4-difluorophenyl)methyl]piperazin-1-yl]-2-[[(2R)-oxolan-2-yl]methyl]isoindole-1,3-dione.
| Compound Name | 4-[4-[(2,4-difluorophenyl)methyl]piperazin-1-yl]-2-[[(2R)-oxolan-2-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 42484794 |
| Molecular Formula | C24H25F2N3O3 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 4-[4-[(2,4-difluorophenyl)methyl]piperazin-1-yl]-2-[[(2R)-oxolan-2-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2cccc(N3CCN(Cc4ccc(F)cc4F)CC3)c2C(=O)N1C[C@H]1CCCO1 |
| InChI | InChI=1S/C24H25F2N3O3/c25-17-7-6-16(20(26)13-17)14-27-8-10-28(11-9-27)21-5-1-4-19-22(21)24(31)29(23(19)30)15-18-3-2-12-32-18/h1,4-7,13,18H,2-3,8-12,14-15H2/t18-/m1/s1 |
| InChIKey | WWTYHEYCSKCMAG-GOSISDBHSA-N |
| XLogP | 3.06 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|