C13H11F2NO3 — CID 55090457
4,6-difluoro-1-(oxolan-2-ylmethyl)indole-2,3-dione (PubChem CID 55090457) has the molecular formula C13H11F2NO3 and a molecular weight of 267.23 g/mol. Its IUPAC name is 4,6-difluoro-1-(oxolan-2-ylmethyl)indole-2,3-dione.
| Compound Name | 4,6-difluoro-1-(oxolan-2-ylmethyl)indole-2,3-dione |
|---|---|
| PubChem CID | 55090457 |
| Molecular Formula | C13H11F2NO3 |
| Molecular Weight | 267.23 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 4,6-difluoro-1-(oxolan-2-ylmethyl)indole-2,3-dione |
| SMILES | O=C1C(=O)N(CC2CCCO2)c2cc(F)cc(F)c21 |
| InChI | InChI=1S/C13H11F2NO3/c14-7-4-9(15)11-10(5-7)16(13(18)12(11)17)6-8-2-1-3-19-8/h4-5,8H,1-3,6H2 |
| InChIKey | ZXCKKDQURJMBLU-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.23 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|