C15H17NO3 — CID 40961478
5-methyl-1-[[(2R)-oxan-2-yl]methyl]indole-2,3-dione (PubChem CID 40961478) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is 5-methyl-1-[[(2R)-oxan-2-yl]methyl]indole-2,3-dione.
| Compound Name | 5-methyl-1-[[(2R)-oxan-2-yl]methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 40961478 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 5-methyl-1-[[(2R)-oxan-2-yl]methyl]indole-2,3-dione |
| SMILES | Cc1ccc2c(c1)C(=O)C(=O)N2C[C@H]1CCCCO1 |
| InChI | InChI=1S/C15H17NO3/c1-10-5-6-13-12(8-10)14(17)15(18)16(13)9-11-4-2-3-7-19-11/h5-6,8,11H,2-4,7,9H2,1H3/t11-/m1/s1 |
| InChIKey | MTIAOOPRIWPFHA-LLVKDONJSA-N |
| XLogP | 2.09 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|