C14H11F3N2O2 — CID 110448780
4,5,6-trifluoro-3-oxo-2-(oxolan-2-ylmethyl)-1H-isoindole-1-carbonitrile (PubChem CID 110448780) has the molecular formula C14H11F3N2O2 and a molecular weight of 296.25 g/mol. Its IUPAC name is 4,5,6-trifluoro-3-oxo-2-(oxolan-2-ylmethyl)-1H-isoindole-1-carbonitrile.
| Compound Name | 4,5,6-trifluoro-3-oxo-2-(oxolan-2-ylmethyl)-1H-isoindole-1-carbonitrile |
|---|---|
| PubChem CID | 110448780 |
| Molecular Formula | C14H11F3N2O2 |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 4,5,6-trifluoro-3-oxo-2-(oxolan-2-ylmethyl)-1H-isoindole-1-carbonitrile |
| SMILES | N#CC1c2cc(F)c(F)c(F)c2C(=O)N1CC1CCCO1 |
| InChI | InChI=1S/C14H11F3N2O2/c15-9-4-8-10(5-18)19(6-7-2-1-3-21-7)14(20)11(8)13(17)12(9)16/h4,7,10H,1-3,6H2 |
| InChIKey | PESNPAIGUUUORP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|