C14H14F2N2O3 — CID 79175165
4,6-difluoro-1-[(4-methylmorpholin-2-yl)methyl]indole-2,3-dione (PubChem CID 79175165) has the molecular formula C14H14F2N2O3 and a molecular weight of 296.27 g/mol. Its IUPAC name is 4,6-difluoro-1-[(4-methylmorpholin-2-yl)methyl]indole-2,3-dione.
| Compound Name | 4,6-difluoro-1-[(4-methylmorpholin-2-yl)methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 79175165 |
| Molecular Formula | C14H14F2N2O3 |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 4,6-difluoro-1-[(4-methylmorpholin-2-yl)methyl]indole-2,3-dione |
| SMILES | CN1CCOC(CN2C(=O)C(=O)c3c(F)cc(F)cc32)C1 |
| InChI | InChI=1S/C14H14F2N2O3/c1-17-2-3-21-9(6-17)7-18-11-5-8(15)4-10(16)12(11)13(19)14(18)20/h4-5,9H,2-3,6-7H2,1H3 |
| InChIKey | XMWDVXXJASXGIT-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.27 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|