C14H15BrN2O3 — CID 79171085
7-bromo-1-[(4-methylmorpholin-2-yl)methyl]indole-2,3-dione (PubChem CID 79171085) has the molecular formula C14H15BrN2O3 and a molecular weight of 339.19 g/mol. Its IUPAC name is 7-bromo-1-[(4-methylmorpholin-2-yl)methyl]indole-2,3-dione.
| Compound Name | 7-bromo-1-[(4-methylmorpholin-2-yl)methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 79171085 |
| Molecular Formula | C14H15BrN2O3 |
| Molecular Weight | 339.19 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 7-bromo-1-[(4-methylmorpholin-2-yl)methyl]indole-2,3-dione |
| SMILES | CN1CCOC(CN2C(=O)C(=O)c3cccc(Br)c32)C1 |
| InChI | InChI=1S/C14H15BrN2O3/c1-16-5-6-20-9(7-16)8-17-12-10(13(18)14(17)19)3-2-4-11(12)15/h2-4,9H,5-8H2,1H3 |
| InChIKey | DJCZBRZOJOKMHH-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.19 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|