C14H14ClFN2O3 — CID 79175249
4-chloro-7-fluoro-1-[(4-methylmorpholin-2-yl)methyl]indole-2,3-dione (PubChem CID 79175249) has the molecular formula C14H14ClFN2O3 and a molecular weight of 312.73 g/mol. Its IUPAC name is 4-chloro-7-fluoro-1-[(4-methylmorpholin-2-yl)methyl]indole-2,3-dione.
| Compound Name | 4-chloro-7-fluoro-1-[(4-methylmorpholin-2-yl)methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 79175249 |
| Molecular Formula | C14H14ClFN2O3 |
| Molecular Weight | 312.73 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 4-chloro-7-fluoro-1-[(4-methylmorpholin-2-yl)methyl]indole-2,3-dione |
| SMILES | CN1CCOC(CN2C(=O)C(=O)c3c(Cl)ccc(F)c32)C1 |
| InChI | InChI=1S/C14H14ClFN2O3/c1-17-4-5-21-8(6-17)7-18-12-10(16)3-2-9(15)11(12)13(19)14(18)20/h2-3,8H,4-7H2,1H3 |
| InChIKey | HTLQKPURMZCQMO-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.73 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|