C27H28ClN5O3 — CID 42436207
4-[4-[[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methyl]piperazin-1-yl]-2-[[(2S)-oxolan-2-yl]methyl]isoindole-1,3-dione (PubChem CID 42436207) has the molecular formula C27H28ClN5O3 and a molecular weight of 506.01 g/mol. Its IUPAC name is 4-[4-[[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methyl]piperazin-1-yl]-2-[[(2S)-oxolan-2-yl]methyl]isoindole-1,3-dione.
| Compound Name | 4-[4-[[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methyl]piperazin-1-yl]-2-[[(2S)-oxolan-2-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 42436207 |
| Molecular Formula | C27H28ClN5O3 |
| Molecular Weight | 506.01 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | 4-[4-[[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methyl]piperazin-1-yl]-2-[[(2S)-oxolan-2-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2cccc(N3CCN(Cc4cn[nH]c4-c4ccc(Cl)cc4)CC3)c2C(=O)N1C[C@@H]1CCCO1 |
| InChI | InChI=1S/C27H28ClN5O3/c28-20-8-6-18(7-9-20)25-19(15-29-30-25)16-31-10-12-32(13-11-31)23-5-1-4-22-24(23)27(35)33(26(22)34)17-21-3-2-14-36-21/h1,4-9,15,21H,2-3,10-14,16-17H2,(H,29,30)/t21-/m0/s1 |
| InChIKey | CGTBZMQLPFVBMX-NRFANRHFSA-N |
| XLogP | 3.83 |
| TPSA | 81.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.01 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|