C27H27N3O5S — CID 42167455
2-[(2,3-dimethoxyphenyl)methyl]-4-[4-(3-methylthiophene-2-carbonyl)piperazin-1-yl]isoindole-1,3-dione (PubChem CID 42167455) has the molecular formula C27H27N3O5S and a molecular weight of 505.60 g/mol. Its IUPAC name is 2-[(2,3-dimethoxyphenyl)methyl]-4-[4-(3-methylthiophene-2-carbonyl)piperazin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2,3-dimethoxyphenyl)methyl]-4-[4-(3-methylthiophene-2-carbonyl)piperazin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 42167455 |
| Molecular Formula | C27H27N3O5S |
| Molecular Weight | 505.60 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | 2-[(2,3-dimethoxyphenyl)methyl]-4-[4-(3-methylthiophene-2-carbonyl)piperazin-1-yl]isoindole-1,3-dione |
| SMILES | COc1cccc(CN2C(=O)c3cccc(N4CCN(C(=O)c5sccc5C)CC4)c3C2=O)c1OC |
| InChI | InChI=1S/C27H27N3O5S/c1-17-10-15-36-24(17)27(33)29-13-11-28(12-14-29)20-8-5-7-19-22(20)26(32)30(25(19)31)16-18-6-4-9-21(34-2)23(18)35-3/h4-10,15H,11-14,16H2,1-3H3 |
| InChIKey | KKRLRHCTQSFVNJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.60 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|