C29H32N4O3 — CID 45169680
N-butyl-1-[1,3-dioxo-2-(quinolin-3-ylmethyl)isoindol-4-yl]-N-methylpiperidine-3-carboxamide (PubChem CID 45169680) has the molecular formula C29H32N4O3 and a molecular weight of 484.60 g/mol. Its IUPAC name is N-butyl-1-[1,3-dioxo-2-(quinolin-3-ylmethyl)isoindol-4-yl]-N-methylpiperidine-3-carboxamide.
| Compound Name | N-butyl-1-[1,3-dioxo-2-(quinolin-3-ylmethyl)isoindol-4-yl]-N-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 45169680 |
| Molecular Formula | C29H32N4O3 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | N-butyl-1-[1,3-dioxo-2-(quinolin-3-ylmethyl)isoindol-4-yl]-N-methylpiperidine-3-carboxamide |
| SMILES | CCCCN(C)C(=O)C1CCCN(c2cccc3c2C(=O)N(Cc2cnc4ccccc4c2)C3=O)C1 |
| InChI | InChI=1S/C29H32N4O3/c1-3-4-14-31(2)27(34)22-10-8-15-32(19-22)25-13-7-11-23-26(25)29(36)33(28(23)35)18-20-16-21-9-5-6-12-24(21)30-17-20/h5-7,9,11-13,16-17,22H,3-4,8,10,14-15,18-19H2,1-2H3 |
| InChIKey | JRKKCACCQHNVSF-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|