C25H33N5O3 — CID 26402895
N-butyl-1-[2-[(1,3-dimethylpyrazol-4-yl)methyl]-1,3-dioxoisoindol-4-yl]-N-methylpiperidine-4-carboxamide (PubChem CID 26402895) has the molecular formula C25H33N5O3 and a molecular weight of 451.57 g/mol. Its IUPAC name is N-butyl-1-[2-[(1,3-dimethylpyrazol-4-yl)methyl]-1,3-dioxoisoindol-4-yl]-N-methylpiperidine-4-carboxamide.
| Compound Name | N-butyl-1-[2-[(1,3-dimethylpyrazol-4-yl)methyl]-1,3-dioxoisoindol-4-yl]-N-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 26402895 |
| Molecular Formula | C25H33N5O3 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | N-butyl-1-[2-[(1,3-dimethylpyrazol-4-yl)methyl]-1,3-dioxoisoindol-4-yl]-N-methylpiperidine-4-carboxamide |
| SMILES | CCCCN(C)C(=O)C1CCN(c2cccc3c2C(=O)N(Cc2cn(C)nc2C)C3=O)CC1 |
| InChI | InChI=1S/C25H33N5O3/c1-5-6-12-27(3)23(31)18-10-13-29(14-11-18)21-9-7-8-20-22(21)25(33)30(24(20)32)16-19-15-28(4)26-17(19)2/h7-9,15,18H,5-6,10-14,16H2,1-4H3 |
| InChIKey | ZWFJFODQHATFSN-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 78.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|