C25H31N5O3 — CID 42433445
N-cyclopentyl-1-[2-[(1,3-dimethylpyrazol-4-yl)methyl]-1,3-dioxoisoindol-4-yl]piperidine-4-carboxamide (PubChem CID 42433445) has the molecular formula C25H31N5O3 and a molecular weight of 449.56 g/mol. Its IUPAC name is N-cyclopentyl-1-[2-[(1,3-dimethylpyrazol-4-yl)methyl]-1,3-dioxoisoindol-4-yl]piperidine-4-carboxamide.
| Compound Name | N-cyclopentyl-1-[2-[(1,3-dimethylpyrazol-4-yl)methyl]-1,3-dioxoisoindol-4-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 42433445 |
| Molecular Formula | C25H31N5O3 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | N-cyclopentyl-1-[2-[(1,3-dimethylpyrazol-4-yl)methyl]-1,3-dioxoisoindol-4-yl]piperidine-4-carboxamide |
| SMILES | Cc1nn(C)cc1CN1C(=O)c2cccc(N3CCC(C(=O)NC4CCCC4)CC3)c2C1=O |
| InChI | InChI=1S/C25H31N5O3/c1-16-18(14-28(2)27-16)15-30-24(32)20-8-5-9-21(22(20)25(30)33)29-12-10-17(11-13-29)23(31)26-19-6-3-4-7-19/h5,8-9,14,17,19H,3-4,6-7,10-13,15H2,1-2H3,(H,26,31) |
| InChIKey | ZXPPWRJUIOMAJM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|