C28H31N5O4 — CID 42433227
1-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]-1,3-dioxoisoindol-4-yl]-N-[[(1S,2S,4S)-spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-yl]methyl]piperidine-4-carboxamide (PubChem CID 42433227) has the molecular formula C28H31N5O4 and a molecular weight of 501.59 g/mol. Its IUPAC name is 1-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]-1,3-dioxoisoindol-4-yl]-N-[[(1S,2S,4S)-spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-yl]methyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]-1,3-dioxoisoindol-4-yl]-N-[[(1S,2S,4S)-spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-yl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 42433227 |
| Molecular Formula | C28H31N5O4 |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | 1-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)methyl]-1,3-dioxoisoindol-4-yl]-N-[[(1S,2S,4S)-spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-yl]methyl]piperidine-4-carboxamide |
| SMILES | Cc1nonc1CN1C(=O)c2cccc(N3CCC(C(=O)NC[C@H]4C[C@H]5C=C[C@@H]4C54CC4)CC3)c2C1=O |
| InChI | InChI=1S/C28H31N5O4/c1-16-22(31-37-30-16)15-33-26(35)20-3-2-4-23(24(20)27(33)36)32-11-7-17(8-12-32)25(34)29-14-18-13-19-5-6-21(18)28(19)9-10-28/h2-6,17-19,21H,7-15H2,1H3,(H,29,34)/t18-,19-,21+/m1/s1 |
| InChIKey | BJARVTDQCVNBMV-SBHAEUEKSA-N |
| XLogP | 3.11 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|