C30H30ClN3O4 — CID 45180898
N-benzyl-1-[2-[(2-chlorophenyl)methyl]-1,3-dioxoisoindol-4-yl]-N-(2-hydroxyethyl)piperidine-4-carboxamide (PubChem CID 45180898) has the molecular formula C30H30ClN3O4 and a molecular weight of 532.04 g/mol. Its IUPAC name is N-benzyl-1-[2-[(2-chlorophenyl)methyl]-1,3-dioxoisoindol-4-yl]-N-(2-hydroxyethyl)piperidine-4-carboxamide.
| Compound Name | N-benzyl-1-[2-[(2-chlorophenyl)methyl]-1,3-dioxoisoindol-4-yl]-N-(2-hydroxyethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 45180898 |
| Molecular Formula | C30H30ClN3O4 |
| Molecular Weight | 532.04 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | N-benzyl-1-[2-[(2-chlorophenyl)methyl]-1,3-dioxoisoindol-4-yl]-N-(2-hydroxyethyl)piperidine-4-carboxamide |
| SMILES | O=C(C1CCN(c2cccc3c2C(=O)N(Cc2ccccc2Cl)C3=O)CC1)N(CCO)Cc1ccccc1 |
| InChI | InChI=1S/C30H30ClN3O4/c31-25-11-5-4-9-23(25)20-34-29(37)24-10-6-12-26(27(24)30(34)38)32-15-13-22(14-16-32)28(36)33(17-18-35)19-21-7-2-1-3-8-21/h1-12,22,35H,13-20H2 |
| InChIKey | YHYKBXPOZFYLAC-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.04 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|