C25H27N5O3S — CID 42277312
1-[1,3-dioxo-2-(thiophen-2-ylmethyl)isoindol-4-yl]-N-methyl-N-(2-pyrazol-1-ylethyl)piperidine-4-carboxamide (PubChem CID 42277312) has the molecular formula C25H27N5O3S and a molecular weight of 477.59 g/mol. Its IUPAC name is 1-[1,3-dioxo-2-(thiophen-2-ylmethyl)isoindol-4-yl]-N-methyl-N-(2-pyrazol-1-ylethyl)piperidine-4-carboxamide.
| Compound Name | 1-[1,3-dioxo-2-(thiophen-2-ylmethyl)isoindol-4-yl]-N-methyl-N-(2-pyrazol-1-ylethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 42277312 |
| Molecular Formula | C25H27N5O3S |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | 1-[1,3-dioxo-2-(thiophen-2-ylmethyl)isoindol-4-yl]-N-methyl-N-(2-pyrazol-1-ylethyl)piperidine-4-carboxamide |
| SMILES | CN(CCn1cccn1)C(=O)C1CCN(c2cccc3c2C(=O)N(Cc2cccs2)C3=O)CC1 |
| InChI | InChI=1S/C25H27N5O3S/c1-27(14-15-29-11-4-10-26-29)23(31)18-8-12-28(13-9-18)21-7-2-6-20-22(21)25(33)30(24(20)32)17-19-5-3-16-34-19/h2-7,10-11,16,18H,8-9,12-15,17H2,1H3 |
| InChIKey | CXASXKJRGOYVEK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 78.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|