C32H36N4O3S — CID 125178672
4-[(3R)-3-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]piperidin-1-yl]-2-[(1S)-1-thiophen-2-ylethyl]isoindole-1,3-dione (PubChem CID 125178672) has the molecular formula C32H36N4O3S and a molecular weight of 556.73 g/mol. Its IUPAC name is 4-[(3R)-3-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]piperidin-1-yl]-2-[(1S)-1-thiophen-2-ylethyl]isoindole-1,3-dione.
| Compound Name | 4-[(3R)-3-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]piperidin-1-yl]-2-[(1S)-1-thiophen-2-ylethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 125178672 |
| Molecular Formula | C32H36N4O3S |
| Molecular Weight | 556.73 g/mol |
| Exact Mass | 556.25 |
| IUPAC Name | 4-[(3R)-3-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]piperidin-1-yl]-2-[(1S)-1-thiophen-2-ylethyl]isoindole-1,3-dione |
| SMILES | Cc1cccc(N2CCN(C(=O)[C@@H]3CCCN(c4cccc5c4C(=O)N([C@@H](C)c4cccs4)C5=O)C3)CC2)c1C |
| InChI | InChI=1S/C32H36N4O3S/c1-21-8-4-11-26(22(21)2)33-15-17-34(18-16-33)30(37)24-9-6-14-35(20-24)27-12-5-10-25-29(27)32(39)36(31(25)38)23(3)28-13-7-19-40-28/h4-5,7-8,10-13,19,23-24H,6,9,14-18,20H2,1-3H3/t23-,24+/m0/s1 |
| InChIKey | SMQAJGLSMLZBIE-BJKOFHAPSA-N |
| XLogP | 5.29 |
| TPSA | 64.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.73 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|