C32H36N4O4S — CID 45252976
4-[3-[4-(2-ethoxyphenyl)piperazine-1-carbonyl]piperidin-1-yl]-2-(1-thiophen-2-ylethyl)isoindole-1,3-dione (PubChem CID 45252976) has the molecular formula C32H36N4O4S and a molecular weight of 572.73 g/mol. Its IUPAC name is 4-[3-[4-(2-ethoxyphenyl)piperazine-1-carbonyl]piperidin-1-yl]-2-(1-thiophen-2-ylethyl)isoindole-1,3-dione.
| Compound Name | 4-[3-[4-(2-ethoxyphenyl)piperazine-1-carbonyl]piperidin-1-yl]-2-(1-thiophen-2-ylethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 45252976 |
| Molecular Formula | C32H36N4O4S |
| Molecular Weight | 572.73 g/mol |
| Exact Mass | 572.25 |
| IUPAC Name | 4-[3-[4-(2-ethoxyphenyl)piperazine-1-carbonyl]piperidin-1-yl]-2-(1-thiophen-2-ylethyl)isoindole-1,3-dione |
| SMILES | CCOc1ccccc1N1CCN(C(=O)C2CCCN(c3cccc4c3C(=O)N(C(C)c3cccs3)C4=O)C2)CC1 |
| InChI | InChI=1S/C32H36N4O4S/c1-3-40-27-13-5-4-11-25(27)33-16-18-34(19-17-33)30(37)23-9-7-15-35(21-23)26-12-6-10-24-29(26)32(39)36(31(24)38)22(2)28-14-8-20-41-28/h4-6,8,10-14,20,22-23H,3,7,9,15-19,21H2,1-2H3 |
| InChIKey | NSWRNSMHLQKLPD-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 73.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.73 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|