C26H33N5O3S — CID 25465158
1-[1,3-dioxo-2-[(1S)-1-(1,3-thiazol-2-yl)ethyl]isoindol-4-yl]-N-(2-piperidin-1-ylethyl)piperidine-4-carboxamide (PubChem CID 25465158) has the molecular formula C26H33N5O3S and a molecular weight of 495.65 g/mol. Its IUPAC name is 1-[1,3-dioxo-2-[(1S)-1-(1,3-thiazol-2-yl)ethyl]isoindol-4-yl]-N-(2-piperidin-1-ylethyl)piperidine-4-carboxamide.
| Compound Name | 1-[1,3-dioxo-2-[(1S)-1-(1,3-thiazol-2-yl)ethyl]isoindol-4-yl]-N-(2-piperidin-1-ylethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 25465158 |
| Molecular Formula | C26H33N5O3S |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | 1-[1,3-dioxo-2-[(1S)-1-(1,3-thiazol-2-yl)ethyl]isoindol-4-yl]-N-(2-piperidin-1-ylethyl)piperidine-4-carboxamide |
| SMILES | C[C@@H](c1nccs1)N1C(=O)c2cccc(N3CCC(C(=O)NCCN4CCCCC4)CC3)c2C1=O |
| InChI | InChI=1S/C26H33N5O3S/c1-18(24-28-11-17-35-24)31-25(33)20-6-5-7-21(22(20)26(31)34)30-14-8-19(9-15-30)23(32)27-10-16-29-12-3-2-4-13-29/h5-7,11,17-19H,2-4,8-10,12-16H2,1H3,(H,27,32)/t18-/m0/s1 |
| InChIKey | QNHHZCFQEUJTPU-SFHVURJKSA-N |
| XLogP | 3.32 |
| TPSA | 85.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|