C18H20N2O — CID 162059497
6-amino-5-(4-tert-butylphenyl)-1,3-dihydroindol-2-one (PubChem CID 162059497) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is 6-amino-5-(4-tert-butylphenyl)-1,3-dihydroindol-2-one.
| Compound Name | 6-amino-5-(4-tert-butylphenyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 162059497 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 6-amino-5-(4-tert-butylphenyl)-1,3-dihydroindol-2-one |
| SMILES | CC(C)(C)c1ccc(-c2cc3c(cc2N)NC(=O)C3)cc1 |
| InChI | InChI=1S/C18H20N2O/c1-18(2,3)13-6-4-11(5-7-13)14-8-12-9-17(21)20-16(12)10-15(14)19/h4-8,10H,9,19H2,1-3H3,(H,20,21) |
| InChIKey | YPXSSBHSMQTQPS-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|