C18H29N3O — CID 91511607
5,6-bis(3-amino-3-methylbutyl)-1,3-dihydroindol-2-one (PubChem CID 91511607) has the molecular formula C18H29N3O and a molecular weight of 303.45 g/mol. Its IUPAC name is 5,6-bis(3-amino-3-methylbutyl)-1,3-dihydroindol-2-one.
| Compound Name | 5,6-bis(3-amino-3-methylbutyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 91511607 |
| Molecular Formula | C18H29N3O |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.23 |
| IUPAC Name | 5,6-bis(3-amino-3-methylbutyl)-1,3-dihydroindol-2-one |
| SMILES | CC(C)(N)CCc1cc2c(cc1CCC(C)(C)N)NC(=O)C2 |
| InChI | InChI=1S/C18H29N3O/c1-17(2,19)7-5-12-9-14-11-16(22)21-15(14)10-13(12)6-8-18(3,4)20/h9-10H,5-8,11,19-20H2,1-4H3,(H,21,22) |
| InChIKey | BRQPOSJVNWPZTN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |