C14H15FN2O5S — CID 154744217
2-[(7-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonylamino]pent-4-enoic acid (PubChem CID 154744217) has the molecular formula C14H15FN2O5S and a molecular weight of 342.35 g/mol. Its IUPAC name is 2-[(7-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonylamino]pent-4-enoic acid.
| Compound Name | 2-[(7-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonylamino]pent-4-enoic acid |
|---|---|
| PubChem CID | 154744217 |
| Molecular Formula | C14H15FN2O5S |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 2-[(7-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonylamino]pent-4-enoic acid |
| SMILES | C=CCC(NS(=O)(=O)c1cc2c(cc1F)NC(=O)CC2)C(=O)O |
| InChI | InChI=1S/C14H15FN2O5S/c1-2-3-10(14(19)20)17-23(21,22)12-6-8-4-5-13(18)16-11(8)7-9(12)15/h2,6-7,10,17H,1,3-5H2,(H,16,18)(H,19,20) |
| InChIKey | PGHBERVXUYIGER-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|