C24H18FNO5 — CID 39976920
[4-(4-fluorobenzoyl)phenyl] 2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]acetate (PubChem CID 39976920) has the molecular formula C24H18FNO5 and a molecular weight of 419.41 g/mol. Its IUPAC name is [4-(4-fluorobenzoyl)phenyl] 2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]acetate.
| Compound Name | [4-(4-fluorobenzoyl)phenyl] 2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]acetate |
|---|---|
| PubChem CID | 39976920 |
| Molecular Formula | C24H18FNO5 |
| Molecular Weight | 419.41 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | [4-(4-fluorobenzoyl)phenyl] 2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]acetate |
| SMILES | O=C1CCc2cc(OCC(=O)Oc3ccc(C(=O)c4ccc(F)cc4)cc3)ccc2N1 |
| InChI | InChI=1S/C24H18FNO5/c25-18-6-1-15(2-7-18)24(29)16-3-8-19(9-4-16)31-23(28)14-30-20-10-11-21-17(13-20)5-12-22(27)26-21/h1-4,6-11,13H,5,12,14H2,(H,26,27) |
| InChIKey | WAONHMTUMZGUEC-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.41 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|