C23H19NO6 — CID 55572616
methyl 3-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]acetyl]oxynaphthalene-2-carboxylate (PubChem CID 55572616) has the molecular formula C23H19NO6 and a molecular weight of 405.41 g/mol. Its IUPAC name is methyl 3-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]acetyl]oxynaphthalene-2-carboxylate.
| Compound Name | methyl 3-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]acetyl]oxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 55572616 |
| Molecular Formula | C23H19NO6 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | methyl 3-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]acetyl]oxynaphthalene-2-carboxylate |
| SMILES | COC(=O)c1cc2ccccc2cc1OC(=O)COc1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C23H19NO6/c1-28-23(27)18-11-14-4-2-3-5-15(14)12-20(18)30-22(26)13-29-17-7-8-19-16(10-17)6-9-21(25)24-19/h2-5,7-8,10-12H,6,9,13H2,1H3,(H,24,25) |
| InChIKey | XOEXDNDHIKJUPS-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|